1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250 251 252 253 254 255 256 257 258 259 260 261 262 263 264 265 266 267 268 269
|
/*****************************************************************************
*
* MODULE: SQL statement parser library
*
* AUTHOR(S): lex.l and yac.y were originaly taken from unixODBC and
* probably written by Peter Harvey <pharvey@codebydesigns.com>,
* modifications and other code by Radim Blazek
*
* PURPOSE: Parse input string containing SQL statement to
* SQLPSTMT structure.
* SQL parser may be used by simple database drivers.
*
* COPYRIGHT: (C) 2000 by the GRASS Development Team
*
* This program is free software under the GNU General Public
* License (>=v2). Read the file COPYING that comes with GRASS
* for details.
*
*****************************************************************************/
/**************** C-CODE *****************/
%{
#include "sqlp.h"
#include "y.tab.h"
#include <string.h>
#undef YY_INPUT
#define YY_INPUT(b, r, ms) (r = my_yyinput(b, ms))
%}
/*************** LEX HEADER **************/
%e 1200
/**************** LEX BODY ****************/
%%
/***************************************
* LITERALS KEYWORDS TOKENS
***************************************/
/* following case insensitives are ugly
but I do not know better at this time */
[Aa][Dd][Dd] { return ADD; }
[Aa][Ll][Tt][Ee][Rr] { return ALTER; }
[Cc][Oo][Ll][Uu][Mm][Nn] { return COLUMN; }
[Dd][Ee][Ll][Ee][Tt][Ee] { return DELETE; }
[Ff][Rr][Oo][Mm] { return FROM; }
[Ii][Nn][Ss][Ee][Rr][Tt] { return INSERT; }
[Ii][Nn][Tt][Oo] { return INTO; }
[Ss][Ee][Ll][Ee][Cc][Tt] { return SELECT; }
[Ss][Ee][Tt] { return SET; }
[Uu][Pp][Dd][Aa][Tt][Ee] { return UPDATE; }
[Vv][Aa][Ll][Uu][Ee][Ss] { return VALUES; }
[Ww][Hh][Ee][Rr][Ee] { return WHERE; }
[Aa][Nn][Dd] { return AND; }
[Cc][Rr][Ee][Aa][Tt][Ee] { return CREATE; }
[Dd][Rr][Oo][Pp] { return DROP; }
[Tt][Aa][Bb][Ll][Ee] { return TABLE; }
[Nn][Uu][Ll][Ll] { return NULL_VALUE; }
[Vv][Aa][Rr][Cc][Hh][Aa][Rr] { return VARCHAR; }
[Ii][Nn][Tt] { return INT; }
[Ii][Nn][Tt][Ee][Gg][Ee][Rr] { return INTEGER; }
[Dd][Oo][Uu][Bb][Ll][Ee] { return DOUBLE; }
[Pp][Rr][Ee][Cc][Ii][Ss][Ii][Oo][Nn] { return PRECISION; }
[Dd][Aa][Tt][Ee] { return DATE; }
[Oo][Rr] { return OR; }
[Nn][Oo][Tt] { return NOT; }
[Oo][Rr][Dd][Ee][Rr] { return ORDER; }
[Bb][Yy] { return BY; }
[Ii][Ss] { return IS; }
/* [Dd][Ii][Ss][Tt][Ii][Nn][Cc][Tt] { return DISTINCT; } */
/***************************************
* EQUAL
***************************************/
"=" {
return EQUAL;
}
/***************************************
* ARITHMETICAL OPERATOR
* Conflict of * as operator with * as all columns, what to do?
***************************************/
"+" |
"-" |
"/" {
yylval.strval = (char*)strdup(yytext);
return ARITHMETICAL_OPERATOR;
}
/***************************************
* COMPARISON OPERATOR
***************************************/
"<>" |
"<" |
">" |
"<=" |
">=" |
"~" {
yylval.strval = (char*)strdup(yytext);
return COMPARISON_OPERATOR;
}
/***************************************
* PUNCTUATION
***************************************/
[-+*/:(),.;] {
yylval.strval = (char*)strdup(yytext);
return yytext[0];
}
/***************************************
* NAMES
***************************************/
[A-Za-z][A-Za-z0-9_]* {
yylval.strval = (char*)strdup(yytext);
return NAME;
}
/***************************************
* INTEGER
***************************************/
[+-]?[0-9]+ {
yylval.intval = atoi(yytext);
/* yylval.strval = (char*)strdup(yytext); */
return INTNUM;
}
/***************************************
* FLOATING POINT NUM
***************************************/
"."[0-9]* |
[+-]?[0-9]+"."[0-9]* |
[+-]?[0-9]+[eE][+-]?[0-9]+ |
[+-]?[0-9]+"."[0-9]*[eE][+-]?[0-9]+ |
"."[0-9]*[eE][+-]?[0-9]+ {
yylval.floatval = atof(yytext);
/* yylval.strval = (char*)strdup(yytext); */
return FLOATNUM;
}
/***************************************
* STRINGS (single quotes)
***************************************/
'[^']*' {
char *Buffer, *ptra, *ptrb;
int c = input();
int len;
Buffer = (char*)strdup(yytext); /* store here because we lose it when unput() */
unput( c ); /* just peeking - checking for a double quote... embedded quote */
if ( c != '\'' )
{
len = strlen (Buffer);
Buffer[len-1] = '\0';
/* Hopefully replace all '' by ' */
ptrb = Buffer + 1;
while ( (ptra = strchr(ptrb, '\'')) != NULL ) {
ptra++; ptrb = ptra;
while ( ptra[1] != 0 ) { ptra[0] = ptra[1]; ptra++; }
ptra[0] = 0;
}
yylval.strval = (char*)strdup(Buffer+1);
free( Buffer );
return STRING;
}
else
{
free( Buffer );
yymore();
}
}
/***************************************
* STRINGS (unterminated)
***************************************/
'[^'\n]*$ { yyerror("Unterminated string"); }
/***************************************
* NEW LINE (ignored)
***************************************/
\n ;
/***************************************
* WHITE SPACE (ignored)
***************************************/
[ \t\r]+ ; /* white space */
/***************************************
* COMMENTS (ignored)
***************************************/
"--".*$ ; /* comment */
%%
/**********************************************************************
*
* C-CODE
*
**********************************************************************/
/**********************************************************************
* my_yyinput
*
* Lexer will ask this function for input when it requires more.
*
**********************************************************************/
int my_yyinput(char *buf, int max_size)
{
int rest, n;
rest = sqlpStmt->stmt + strlen( sqlpStmt->stmt) - sqlpStmt->cur;
n = ( max_size < rest ? max_size : rest );
if ( n > 0 )
{
memcpy( buf, sqlpStmt->cur, n );
sqlpStmt->cur += n;
}
return n;
}
/**********************************************************************
* yyerror
*
* This should be called just before failing. It formats a meaningfull
* message and deposits it in a usefull place.
*
**********************************************************************/
void yyerror( char *s )
{
snprintf( sqlpStmt->errmsg, 500, "%s processing '%s'", s, yytext );
yy_flush_buffer(YY_CURRENT_BUFFER);
}
/**********************************************************************
* yywrap
*
* We are not doing any buffer switching but lets not use the Flex version of
* of this func anyway so we can avoid the link dependency.
*
**********************************************************************/
int yywrap()
{
return 1;
}
|