1 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51 52 53 54 55 56 57 58 59 60 61 62 63 64 65 66 67 68 69 70 71 72 73 74 75 76 77 78 79 80 81 82 83 84 85 86 87 88 89 90 91 92 93 94 95 96 97 98 99 100 101 102 103 104 105 106 107 108 109 110 111 112 113 114 115 116 117 118 119 120 121 122 123 124 125 126 127 128 129 130 131 132 133 134 135 136 137 138 139 140 141 142 143 144 145 146 147 148 149 150 151 152 153 154 155 156 157 158 159 160 161 162 163 164 165 166 167 168 169 170 171 172 173 174 175 176 177 178 179 180 181 182 183 184 185 186 187 188 189 190 191 192 193 194 195 196 197 198 199 200 201 202 203 204 205 206 207 208 209 210 211 212 213 214 215 216 217 218 219 220 221 222 223 224 225 226 227 228 229 230 231 232 233 234 235 236 237 238 239 240 241 242 243 244 245 246 247 248 249 250
|
# SPDX-License-Identifier: BSD-2-Clause
#
# Copyright (C) 2023, Raspberry Pi Ltd
#
# ctt_cac.py - CAC (Chromatic Aberration Correction) tuning tool
from PIL import Image
import numpy as np
import matplotlib.pyplot as plt
from matplotlib import cm
from ctt_dots_locator import find_dots_locations
# This is the wrapper file that creates a JSON entry for you to append
# to your camera tuning file.
# It calculates the chromatic aberration at different points throughout
# the image and uses that to produce a martix that can then be used
# in the camera tuning files to correct this aberration.
def pprint_array(array):
# Function to print the array in a tidier format
array = array
output = ""
for i in range(len(array)):
for j in range(len(array[0])):
output += str(round(array[i, j], 2)) + ", "
# Add the necessary indentation to the array
output += "\n "
# Cut off the end of the array (nicely formats it)
return output[:-22]
def plot_shifts(red_shifts, blue_shifts):
# If users want, they can pass a command line option to show the shifts on a graph
# Can be useful to check that the functions are all working, and that the sample
# images are doing the right thing
Xs = np.array(red_shifts)[:, 0]
Ys = np.array(red_shifts)[:, 1]
Zs = np.array(red_shifts)[:, 2]
Zs2 = np.array(red_shifts)[:, 3]
Zs3 = np.array(blue_shifts)[:, 2]
Zs4 = np.array(blue_shifts)[:, 3]
fig, axs = plt.subplots(2, 2)
ax = fig.add_subplot(2, 2, 1, projection='3d')
ax.scatter(Xs, Ys, Zs, cmap=cm.jet, linewidth=0)
ax.set_title('Red X Shift')
ax = fig.add_subplot(2, 2, 2, projection='3d')
ax.scatter(Xs, Ys, Zs2, cmap=cm.jet, linewidth=0)
ax.set_title('Red Y Shift')
ax = fig.add_subplot(2, 2, 3, projection='3d')
ax.scatter(Xs, Ys, Zs3, cmap=cm.jet, linewidth=0)
ax.set_title('Blue X Shift')
ax = fig.add_subplot(2, 2, 4, projection='3d')
ax.scatter(Xs, Ys, Zs4, cmap=cm.jet, linewidth=0)
ax.set_title('Blue Y Shift')
fig.tight_layout()
plt.show()
def shifts_to_yaml(red_shift, blue_shift, image_dimensions, output_grid_size=9):
# Convert the shifts to a numpy array for easier handling and initialise other variables
red_shifts = np.array(red_shift)
blue_shifts = np.array(blue_shift)
# create a grid that's smaller than the output grid, which we then interpolate from to get the output values
xrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
xbgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
yrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
ybgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))
xrsgrid = []
xbsgrid = []
yrsgrid = []
ybsgrid = []
xg = np.zeros((output_grid_size - 1, output_grid_size - 1))
yg = np.zeros((output_grid_size - 1, output_grid_size - 1))
# Format the grids - numpy doesn't work for this, it wants a
# nice uniformly spaced grid, which we don't know if we have yet, hence the rather mundane setup
for x in range(output_grid_size - 1):
xrsgrid.append([])
yrsgrid.append([])
xbsgrid.append([])
ybsgrid.append([])
for y in range(output_grid_size - 1):
xrsgrid[x].append([])
yrsgrid[x].append([])
xbsgrid[x].append([])
ybsgrid[x].append([])
image_size = (image_dimensions[0], image_dimensions[1])
gridxsize = image_size[0] / (output_grid_size - 1)
gridysize = image_size[1] / (output_grid_size - 1)
# Iterate through each dot, and it's shift values and put these into the correct grid location
for red_shift in red_shifts:
xgridloc = int(red_shift[0] / gridxsize)
ygridloc = int(red_shift[1] / gridysize)
xrsgrid[xgridloc][ygridloc].append(red_shift[2])
yrsgrid[xgridloc][ygridloc].append(red_shift[3])
for blue_shift in blue_shifts:
xgridloc = int(blue_shift[0] / gridxsize)
ygridloc = int(blue_shift[1] / gridysize)
xbsgrid[xgridloc][ygridloc].append(blue_shift[2])
ybsgrid[xgridloc][ygridloc].append(blue_shift[3])
# Now calculate the average pixel shift for each square in the grid
grid_incomplete = False
for x in range(output_grid_size - 1):
for y in range(output_grid_size - 1):
if xrsgrid[x][y]:
xrgrid[x, y] = np.mean(xrsgrid[x][y])
else:
grid_incomplete = True
if yrsgrid[x][y]:
yrgrid[x, y] = np.mean(yrsgrid[x][y])
else:
grid_incomplete = True
if xbsgrid[x][y]:
xbgrid[x, y] = np.mean(xbsgrid[x][y])
else:
grid_incomplete = True
if ybsgrid[x][y]:
ybgrid[x, y] = np.mean(ybsgrid[x][y])
else:
grid_incomplete = True
if grid_incomplete:
raise RuntimeError("\nERROR: CAC measurements do not span the image!"
"\nConsider using improved CAC images, or remove them entirely.\n")
# Next, we start to interpolate the central points of the grid that gets passed to the tuning file
input_grids = np.array([xrgrid, yrgrid, xbgrid, ybgrid])
output_grids = np.zeros((4, output_grid_size, output_grid_size))
# Interpolate the centre of the grid
output_grids[:, 1:-1, 1:-1] = (input_grids[:, 1:, :-1] + input_grids[:, 1:, 1:] + input_grids[:, :-1, 1:] + input_grids[:, :-1, :-1]) / 4
# Edge cases:
output_grids[:, 1:-1, 0] = ((input_grids[:, :-1, 0] + input_grids[:, 1:, 0]) / 2 - output_grids[:, 1:-1, 1]) * 2 + output_grids[:, 1:-1, 1]
output_grids[:, 1:-1, -1] = ((input_grids[:, :-1, 7] + input_grids[:, 1:, 7]) / 2 - output_grids[:, 1:-1, -2]) * 2 + output_grids[:, 1:-1, -2]
output_grids[:, 0, 1:-1] = ((input_grids[:, 0, :-1] + input_grids[:, 0, 1:]) / 2 - output_grids[:, 1, 1:-1]) * 2 + output_grids[:, 1, 1:-1]
output_grids[:, -1, 1:-1] = ((input_grids[:, 7, :-1] + input_grids[:, 7, 1:]) / 2 - output_grids[:, -2, 1:-1]) * 2 + output_grids[:, -2, 1:-1]
# Corner Cases:
output_grids[:, 0, 0] = (output_grids[:, 0, 1] - output_grids[:, 1, 1]) + (output_grids[:, 1, 0] - output_grids[:, 1, 1]) + output_grids[:, 1, 1]
output_grids[:, 0, -1] = (output_grids[:, 0, -2] - output_grids[:, 1, -2]) + (output_grids[:, 1, -1] - output_grids[:, 1, -2]) + output_grids[:, 1, -2]
output_grids[:, -1, 0] = (output_grids[:, -1, 1] - output_grids[:, -2, 1]) + (output_grids[:, -2, 0] - output_grids[:, -2, 1]) + output_grids[:, -2, 1]
output_grids[:, -1, -1] = (output_grids[:, -2, -1] - output_grids[:, -2, -2]) + (output_grids[:, -1, -2] - output_grids[:, -2, -2]) + output_grids[:, -2, -2]
# Below, we swap the x and the y coordinates, and also multiply by a factor of -1
# This is due to the PiSP (standard) dimensions being flipped in comparison to
# PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts,
# and the PiSP block asks for the values it should shift by (hence the * -1, to convert from colour shift to a pixel shift)
output_grid_yr, output_grid_xr, output_grid_yb, output_grid_xb = output_grids * -1
return output_grid_xr, output_grid_yr, output_grid_xb, output_grid_yb
def analyse_dot(dot, dot_location=[0, 0]):
# Scan through the dot, calculate the centroid of each colour channel by doing:
# pixel channel brightness * distance from top left corner
# Sum these, and divide by the sum of each channel's brightnesses to get a centroid for each channel
red_channel = np.array(dot)[:, :, 0]
y_num_pixels = len(red_channel[0])
x_num_pixels = len(red_channel)
yred_weight = np.sum(np.dot(red_channel, np.arange(y_num_pixels)))
xred_weight = np.sum(np.dot(np.arange(x_num_pixels), red_channel))
red_sum = np.sum(red_channel)
green_channel = np.array(dot)[:, :, 1]
ygreen_weight = np.sum(np.dot(green_channel, np.arange(y_num_pixels)))
xgreen_weight = np.sum(np.dot(np.arange(x_num_pixels), green_channel))
green_sum = np.sum(green_channel)
blue_channel = np.array(dot)[:, :, 2]
yblue_weight = np.sum(np.dot(blue_channel, np.arange(y_num_pixels)))
xblue_weight = np.sum(np.dot(np.arange(x_num_pixels), blue_channel))
blue_sum = np.sum(blue_channel)
# We return this structure. It contains 2 arrays that contain:
# the locations of the dot center, along with the channel shifts in the x and y direction:
# [ [red_center_x, red_center_y, red_x_shift, red_y_shift], [blue_center_x, blue_center_y, blue_x_shift, blue_y_shift] ]
return [[int(dot_location[0]) + int(len(dot) / 2), int(dot_location[1]) + int(len(dot[0]) / 2), xred_weight / red_sum - xgreen_weight / green_sum, yred_weight / red_sum - ygreen_weight / green_sum], [dot_location[0] + int(len(dot) / 2), dot_location[1] + int(len(dot[0]) / 2), xblue_weight / blue_sum - xgreen_weight / green_sum, yblue_weight / blue_sum - ygreen_weight / green_sum]]
def cac(Cam):
filelist = Cam.imgs_cac
Cam.log += '\nCAC analysing files: {}'.format(str(filelist))
np.set_printoptions(precision=3)
np.set_printoptions(suppress=True)
# Create arrays to hold all the dots data and their colour offsets
red_shift = [] # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]]
blue_shift = []
# Iterate through the files
# Multiple files is reccomended to average out the lens aberration through rotations
for file in filelist:
Cam.log += '\nCAC processing file'
print("\n Processing file")
# Read the raw RGB values
rgb = file.rgb
image_size = [file.h, file.w] # Image size, X, Y
# Create a colour copy of the RGB values to use later in the calibration
imout = Image.new(mode="RGB", size=image_size)
rgb_image = np.array(imout)
# The rgb values need reshaping from a 1d array to a 3d array to be worked with easily
rgb.reshape((image_size[0], image_size[1], 3))
rgb_image = rgb
# Pass the RGB image through to the dots locating program
# Returns an array of the dots (colour rectangles around the dots), and an array of their locations
print("Finding dots")
Cam.log += '\nFinding dots'
dots, dots_locations = find_dots_locations(rgb_image)
# Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out
# by how far the chromatic aberration has shifted each channel
Cam.log += '\nDots found: {}'.format(str(len(dots)))
print('Dots found: ' + str(len(dots)))
for dot, dot_location in zip(dots, dots_locations):
if len(dot) > 0:
if (dot_location[0] > 0) and (dot_location[1] > 0):
ret = analyse_dot(dot, dot_location)
red_shift.append(ret[0])
blue_shift.append(ret[1])
# Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix
# for the CAC block to handle and then store these as a .json file to be added to the camera
# tuning file
print("\nCreating output grid")
Cam.log += '\nCreating output grid'
try:
rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size)
except RuntimeError as e:
print(str(e))
Cam.log += "\nCAC correction failed! CAC will not be enabled."
return {}
print("CAC correction complete!")
Cam.log += '\nCAC correction complete!'
# Give the JSON dict back to the main ctt program
return {"strength": 1.0, "lut_rx": list(rx.round(2).reshape(81)), "lut_ry": list(ry.round(2).reshape(81)), "lut_bx": list(bx.round(2).reshape(81)), "lut_by": list(by.round(2).reshape(81))}
|